C20H32O2 — CID 162969111
(3E,7E,9E,13R)-10-(2-hydroxypropan-2-yl)-3,7,13-trimethylcyclotetradeca-3,7,9-trien-1-one (PubChem CID 162969111) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3E,7E,9E,13R)-10-(2-hydroxypropan-2-yl)-3,7,13-trimethylcyclotetradeca-3,7,9-trien-1-one.
| Compound Name | (3E,7E,9E,13R)-10-(2-hydroxypropan-2-yl)-3,7,13-trimethylcyclotetradeca-3,7,9-trien-1-one |
|---|---|
| PubChem CID | 162969111 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3E,7E,9E,13R)-10-(2-hydroxypropan-2-yl)-3,7,13-trimethylcyclotetradeca-3,7,9-trien-1-one |
| SMILES | C/C1=C\C=C(\C(C)(C)O)CC[C@@H](C)CC(=O)C/C(C)=C/CC1 |
| InChI | InChI=1S/C20H32O2/c1-15-7-6-8-16(2)13-19(21)14-17(3)10-12-18(11-9-15)20(4,5)22/h8-9,11,17,22H,6-7,10,12-14H2,1-5H3/b15-9+,16-8+,18-11+/t17-/m1/s1 |
| InChIKey | KECRMPBXABTDAG-CVQMHHDFSA-N |
| XLogP | 5.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|