C15H20O2 — CID 90980947
(3R,4aS,5R)-3-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-4,4a,5,6-tetrahydronaphthalen-2-one (PubChem CID 90980947) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3R,4aS,5R)-3-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-4,4a,5,6-tetrahydronaphthalen-2-one.
| Compound Name | (3R,4aS,5R)-3-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-4,4a,5,6-tetrahydronaphthalen-2-one |
|---|---|
| PubChem CID | 90980947 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3R,4aS,5R)-3-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-4,4a,5,6-tetrahydronaphthalen-2-one |
| SMILES | C=C(C)[C@@H]1CC=C(C)C2=CC(=O)[C@](C)(O)C[C@H]21 |
| InChI | InChI=1S/C15H20O2/c1-9(2)11-6-5-10(3)12-7-14(16)15(4,17)8-13(11)12/h5,7,11,13,17H,1,6,8H2,2-4H3/t11-,13-,15+/m0/s1 |
| InChIKey | GGXXBOMMYNFEKU-CORIIIEPSA-N |
| XLogP | 2.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|