C19H22O6 — CID 163050267
[(4S,10E,12aR)-3-acetyloxy-6,10-dimethyl-2-oxo-5,9,12,12a-tetrahydro-4H-cycloundeca[b]furan-4-yl] acetate (PubChem CID 163050267) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is [(4S,10E,12aR)-3-acetyloxy-6,10-dimethyl-2-oxo-5,9,12,12a-tetrahydro-4H-cycloundeca[b]furan-4-yl] acetate.
| Compound Name | [(4S,10E,12aR)-3-acetyloxy-6,10-dimethyl-2-oxo-5,9,12,12a-tetrahydro-4H-cycloundeca[b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 163050267 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [(4S,10E,12aR)-3-acetyloxy-6,10-dimethyl-2-oxo-5,9,12,12a-tetrahydro-4H-cycloundeca[b]furan-4-yl] acetate |
| SMILES | CC(=O)OC1=C2[C@@H](OC(C)=O)CC(C)=C=CC/C(C)=C/C[C@H]2OC1=O |
| InChI | InChI=1S/C19H22O6/c1-11-6-5-7-12(2)10-16(23-13(3)20)17-15(9-8-11)25-19(22)18(17)24-14(4)21/h5,8,15-16H,6,9-10H2,1-4H3/b11-8+/t7?,15-,16+/m1/s1 |
| InChIKey | SYBMRWBVSDYBKX-GQOFANNPSA-N |
| XLogP | 2.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|