C18H28O4 — CID 164685927
ethyl 6-oxo-3,4-dipentylpyran-2-carboxylate (PubChem CID 164685927) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is ethyl 6-oxo-3,4-dipentylpyran-2-carboxylate.
| Compound Name | ethyl 6-oxo-3,4-dipentylpyran-2-carboxylate |
|---|---|
| PubChem CID | 164685927 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | ethyl 6-oxo-3,4-dipentylpyran-2-carboxylate |
| SMILES | CCCCCc1cc(=O)oc(C(=O)OCC)c1CCCCC |
| InChI | InChI=1S/C18H28O4/c1-4-7-9-11-14-13-16(19)22-17(18(20)21-6-3)15(14)12-10-8-5-2/h13H,4-12H2,1-3H3 |
| InChIKey | UIRQFDJLJBYACM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|