About 4-butyl-5,6-diethylpyran-2-one
4-butyl-5,6-diethylpyran-2-one (PubChem CID 6422992) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-butyl-5,6-diethylpyran-2-one.
Molecular Properties
| Compound Name | 4-butyl-5,6-diethylpyran-2-one |
| PubChem CID | 6422992 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-butyl-5,6-diethylpyran-2-one |
| SMILES | CCCCc1cc(=O)oc(CC)c1CC |
| InChI | InChI=1S/C13H20O2/c1-4-7-8-10-9-13(14)15-12(6-3)11(10)5-2/h9H,4-8H2,1-3H3 |
| InChIKey | BGWQZZDAKABWSL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butyl-5,6-diethylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5,6-diethylpyran-2-one?
The IUPAC name of 4-butyl-5,6-diethylpyran-2-one (CID 6422992) is 4-butyl-5,6-diethylpyran-2-one.
What is the SMILES notation for 4-butyl-5,6-diethylpyran-2-one?
The canonical SMILES for 4-butyl-5,6-diethylpyran-2-one is CCCCc1cc(=O)oc(CC)c1CC.
What is the InChIKey of 4-butyl-5,6-diethylpyran-2-one?
The InChIKey is BGWQZZDAKABWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-4-7-8-10-9-13(14)15-12(6-3)11(10)5-2/h9H,4-8H2,1-3H3.
What are the key properties of 4-butyl-5,6-diethylpyran-2-one?
4-butyl-5,6-diethylpyran-2-one has a molecular weight of 208.30 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5,6-diethylpyran-2-one is sourced from PubChem (CID 6422992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).