C19H33NO6 — CID 163052449
3-[3-(1-ethoxyethoxy)-3-(3-ethyl-2-methyloxiran-2-yl)-2-methylpropanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 163052449) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-[3-(1-ethoxyethoxy)-3-(3-ethyl-2-methyloxiran-2-yl)-2-methylpropanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-(1-ethoxyethoxy)-3-(3-ethyl-2-methyloxiran-2-yl)-2-methylpropanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 163052449 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 3-[3-(1-ethoxyethoxy)-3-(3-ethyl-2-methyloxiran-2-yl)-2-methylpropanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CCOC(C)OC(C(C)C(=O)N1C(=O)OCC1C(C)C)C1(C)OC1CC |
| InChI | InChI=1S/C19H33NO6/c1-8-15-19(7,26-15)16(25-13(6)23-9-2)12(5)17(21)20-14(11(3)4)10-24-18(20)22/h11-16H,8-10H2,1-7H3 |
| InChIKey | FGIJDCWFUDPZRD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|