C24H45NO6Si — CID 163012733
(4S)-3-[(2R)-2-[(4R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 163012733) has the molecular formula C24H45NO6Si and a molecular weight of 471.71 g/mol. Its IUPAC name is (4S)-3-[(2R)-2-[(4R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R)-2-[(4R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 163012733 |
| Molecular Formula | C24H45NO6Si |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | (4S)-3-[(2R)-2-[(4R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)OC(C)(C)O[C@@H]1[C@@H](C)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C24H45NO6Si/c1-13-18(30-32(11,12)22(5,6)7)24(10)19(29-23(8,9)31-24)16(4)20(26)25-17(15(2)3)14-28-21(25)27/h15-19H,13-14H2,1-12H3/t16-,17-,18-,19-,24-/m1/s1 |
| InChIKey | RGRCZGBEYSJVDE-QRYDCHBUSA-N |
| XLogP | 5.34 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|