C33H63NO9Si2 — CID 11714492
tert-butyl (3S,5R)-3,5-bis[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 11714492) has the molecular formula C33H63NO9Si2 and a molecular weight of 674.04 g/mol. Its IUPAC name is tert-butyl (3S,5R)-3,5-bis[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-3,5-bis[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11714492 |
| Molecular Formula | C33H63NO9Si2 |
| Molecular Weight | 674.04 g/mol |
| Exact Mass | 673.40 |
| IUPAC Name | tert-butyl (3S,5R)-3,5-bis[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H]2COC(C)(C)O2)C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C33H63NO9Si2/c1-29(2,3)41-28(36)34-22(26(24-20-38-33(12,13)40-24)43-45(16,17)31(7,8)9)18-21(27(34)35)25(23-19-37-32(10,11)39-23)42-44(14,15)30(4,5)6/h21-26H,18-20H2,1-17H3/t21-,22+,23+,24+,25-,26-/m0/s1 |
| InChIKey | XDFYERJXFFMAHG-NJPATFAWSA-N |
| XLogP | 7.22 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.04 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|