C21H18O16S — CID 163052707
(2R,3R,4R,5S,6S)-6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-sulfooxychromen-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163052707) has the molecular formula C21H18O16S and a molecular weight of 558.43 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-sulfooxychromen-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S,6S)-6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-sulfooxychromen-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163052707 |
| Molecular Formula | C21H18O16S |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | (2R,3R,4R,5S,6S)-6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-sulfooxychromen-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(OS(=O)(=O)O)cc(O)c3c2=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H18O16S/c22-8-2-1-6(3-9(8)23)17-18(35-21-16(28)14(26)15(27)19(36-21)20(29)30)13(25)12-10(24)4-7(5-11(12)34-17)37-38(31,32)33/h1-5,14-16,19,21-24,26-28H,(H,29,30)(H,31,32,33)/t14-,15-,16+,19-,21-/m1/s1 |
| InChIKey | UZHUMGQOPXDLRD-NESBCBRFSA-N |
| XLogP | -0.97 |
| TPSA | 270.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|