C20H18O14S — CID 163106605
[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-[(2S,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-3-yl] hydrogen sulfate (PubChem CID 163106605) has the molecular formula C20H18O14S and a molecular weight of 514.42 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-[(2S,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-3-yl] hydrogen sulfate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-[(2S,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 163106605 |
| Molecular Formula | C20H18O14S |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-7-[(2S,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-3-yl] hydrogen sulfate |
| SMILES | O=c1c(OS(=O)(=O)O)c(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC[C@@H](O)[C@H](O)[C@@H]3O)cc(O)c12 |
| InChI | InChI=1S/C20H18O14S/c21-9-2-1-7(3-10(9)22)18-19(34-35(28,29)30)16(26)14-11(23)4-8(5-13(14)33-18)32-20-17(27)15(25)12(24)6-31-20/h1-5,12,15,17,20-25,27H,6H2,(H,28,29,30)/t12-,15+,17+,20+/m1/s1 |
| InChIKey | XPYREWKWNDJMCU-ZMQFRBSTSA-N |
| XLogP | -0.42 |
| TPSA | 233.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|