C15H21ClO2 — CID 163055398
(2R)-2-(9-chloro-8-methylnona-5,8-dienyl)-2,3-dihydropyran-6-one (PubChem CID 163055398) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is (2R)-2-(9-chloro-8-methylnona-5,8-dienyl)-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-(9-chloro-8-methylnona-5,8-dienyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 163055398 |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2R)-2-(9-chloro-8-methylnona-5,8-dienyl)-2,3-dihydropyran-6-one |
| SMILES | CC(=CCl)CC=CCCCC[C@@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C15H21ClO2/c1-13(12-16)8-5-3-2-4-6-9-14-10-7-11-15(17)18-14/h3,5,7,11-12,14H,2,4,6,8-10H2,1H3/t14-/m1/s1 |
| InChIKey | VLBAJBDZRVUUIE-CQSZACIVSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|