C9H11NO7S — CID 163056121
(5R,6R)-6-(1-hydroxyethyl)-7-oxo-3-sulfo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 163056121) has the molecular formula C9H11NO7S and a molecular weight of 277.25 g/mol. Its IUPAC name is (5R,6R)-6-(1-hydroxyethyl)-7-oxo-3-sulfo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6R)-6-(1-hydroxyethyl)-7-oxo-3-sulfo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 163056121 |
| Molecular Formula | C9H11NO7S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (5R,6R)-6-(1-hydroxyethyl)-7-oxo-3-sulfo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CC(O)[C@@H]1C(=O)N2C(C(=O)O)=C(S(=O)(=O)O)C[C@H]12 |
| InChI | InChI=1S/C9H11NO7S/c1-3(11)6-4-2-5(18(15,16)17)7(9(13)14)10(4)8(6)12/h3-4,6,11H,2H2,1H3,(H,13,14)(H,15,16,17)/t3?,4-,6+/m1/s1 |
| InChIKey | CYIDAUCFTUSSQY-DUXHBQLLSA-N |
| XLogP | -1.22 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|