C45H74O12 — CID 163056206
5-ethyl-2,11,14,20,29-pentamethyl-23,32-di(propan-2-yl)-4,13,22,31,37,38,39,40-octaoxapentacyclo[32.2.1.17,10.116,19.125,28]tetracontane-3,12,21,30-tetrone (PubChem CID 163056206) has the molecular formula C45H74O12 and a molecular weight of 807.07 g/mol. Its IUPAC name is 5-ethyl-2,11,14,20,29-pentamethyl-23,32-di(propan-2-yl)-4,13,22,31,37,38,39,40-octaoxapentacyclo[32.2.1.17,10.116,19.125,28]tetracontane-3,12,21,30-tetrone.
| Compound Name | 5-ethyl-2,11,14,20,29-pentamethyl-23,32-di(propan-2-yl)-4,13,22,31,37,38,39,40-octaoxapentacyclo[32.2.1.17,10.116,19.125,28]tetracontane-3,12,21,30-tetrone |
|---|---|
| PubChem CID | 163056206 |
| Molecular Formula | C45H74O12 |
| Molecular Weight | 807.07 g/mol |
| Exact Mass | 806.52 |
| IUPAC Name | 5-ethyl-2,11,14,20,29-pentamethyl-23,32-di(propan-2-yl)-4,13,22,31,37,38,39,40-octaoxapentacyclo[32.2.1.17,10.116,19.125,28]tetracontane-3,12,21,30-tetrone |
| SMILES | CCC1CC2CCC(O2)C(C)C(=O)OC(C)CC2CCC(O2)C(C)C(=O)OC(C(C)C)CC2CCC(O2)C(C)C(=O)OC(C(C)C)CC2CCC(O2)C(C)C(=O)O1 |
| InChI | InChI=1S/C45H74O12/c1-11-31-21-33-13-17-36(52-33)27(7)42(46)50-26(6)20-32-12-16-38(51-32)29(9)44(48)56-41(25(4)5)23-35-15-19-39(54-35)30(10)45(49)57-40(24(2)3)22-34-14-18-37(53-34)28(8)43(47)55-31/h24-41H,11-23H2,1-10H3 |
| InChIKey | AQDCLYSSBJQSIV-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.07 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|