C30H48O9 — CID 135756030
(1S,2S,5R,7R,10S,11R,14S,16R,19S,20S,23R,25R)-2,5,11,14,20,23-hexamethyl-4,13,22,28,29,30-hexaoxatetracyclo[23.2.1.17,10.116,19]triacontane-3,12,21-trione (PubChem CID 135756030) has the molecular formula C30H48O9 and a molecular weight of 552.71 g/mol. Its IUPAC name is (1S,2S,5R,7R,10S,11R,14S,16R,19S,20S,23R,25R)-2,5,11,14,20,23-hexamethyl-4,13,22,28,29,30-hexaoxatetracyclo[23.2.1.17,10.116,19]triacontane-3,12,21-trione.
| Compound Name | (1S,2S,5R,7R,10S,11R,14S,16R,19S,20S,23R,25R)-2,5,11,14,20,23-hexamethyl-4,13,22,28,29,30-hexaoxatetracyclo[23.2.1.17,10.116,19]triacontane-3,12,21-trione |
|---|---|
| PubChem CID | 135756030 |
| Molecular Formula | C30H48O9 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | (1S,2S,5R,7R,10S,11R,14S,16R,19S,20S,23R,25R)-2,5,11,14,20,23-hexamethyl-4,13,22,28,29,30-hexaoxatetracyclo[23.2.1.17,10.116,19]triacontane-3,12,21-trione |
| SMILES | C[C@@H]1C[C@H]2CC[C@H](O2)[C@H](C)C(=O)O[C@H](C)C[C@H]2CC[C@H](O2)[C@@H](C)C(=O)O[C@@H](C)C[C@H]2CC[C@H](O2)[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C30H48O9/c1-16-13-22-7-10-26(37-22)20(5)29(32)35-18(3)15-24-9-12-27(39-24)21(6)30(33)36-17(2)14-23-8-11-25(38-23)19(4)28(31)34-16/h16-27H,7-15H2,1-6H3/t16-,17-,18+,19+,20-,21+,22-,23-,24-,25+,26+,27+/m1/s1 |
| InChIKey | WYYHFYCQPHDAJE-CUVMBLRFSA-N |
| XLogP | 4.52 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|