C45H76O5 — CID 163059983
[(2S)-1-hydroxy-3-icos-11-enoyloxypropan-2-yl] docosa-7,10,13,16,19-pentaenoate (PubChem CID 163059983) has the molecular formula C45H76O5 and a molecular weight of 697.10 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-icos-11-enoyloxypropan-2-yl] docosa-7,10,13,16,19-pentaenoate.
| Compound Name | [(2S)-1-hydroxy-3-icos-11-enoyloxypropan-2-yl] docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 163059983 |
| Molecular Formula | C45H76O5 |
| Molecular Weight | 697.10 g/mol |
| Exact Mass | 696.57 |
| IUPAC Name | [(2S)-1-hydroxy-3-icos-11-enoyloxypropan-2-yl] docosa-7,10,13,16,19-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C45H76O5/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-45(48)50-43(41-46)42-49-44(47)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,17-20,22,24,28,30,43,46H,3-4,6,8-10,12,14-16,21,23,25-27,29,31-42H2,1-2H3/t43-/m0/s1 |
| InChIKey | TWCMTRCNZDNRCJ-QLKFWGTOSA-N |
| XLogP | 12.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.10 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|