C6H5N3O — CID 163060383
6-methylfuro[2,3-d]triazine (PubChem CID 163060383) has the molecular formula C6H5N3O and a molecular weight of 135.13 g/mol. Its IUPAC name is 6-methylfuro[2,3-d]triazine.
| Compound Name | 6-methylfuro[2,3-d]triazine |
|---|---|
| PubChem CID | 163060383 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 6-methylfuro[2,3-d]triazine |
| SMILES | Cc1cc2cnnnc2o1 |
| InChI | InChI=1S/C6H5N3O/c1-4-2-5-3-7-9-8-6(5)10-4/h2-3H,1H3 |
| InChIKey | URQIFTYDLBMNCO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |