C7H13N3 — CID 143657712
4,5-dimethyltriazine;ethane (PubChem CID 143657712) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 4,5-dimethyltriazine;ethane.
| Compound Name | 4,5-dimethyltriazine;ethane |
|---|---|
| PubChem CID | 143657712 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 4,5-dimethyltriazine;ethane |
| SMILES | CC.Cc1cnnnc1C |
| InChI | InChI=1S/C5H7N3.C2H6/c1-4-3-6-8-7-5(4)2;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | CJAWFFNDJYJWGY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |