C13H28N2 — CID 142187300
ethane;3,4,5-trimethylpyridazine (PubChem CID 142187300) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is ethane;3,4,5-trimethylpyridazine.
| Compound Name | ethane;3,4,5-trimethylpyridazine |
|---|---|
| PubChem CID | 142187300 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | ethane;3,4,5-trimethylpyridazine |
| SMILES | CC.CC.CC.Cc1cnnc(C)c1C |
| InChI | InChI=1S/C7H10N2.3C2H6/c1-5-4-8-9-7(3)6(5)2;3*1-2/h4H,1-3H3;3*1-2H3 |
| InChIKey | CHEKYAYADDZUSF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |