C13H13FN2 — CID 144623526
4-(2-fluoro-4-methylphenyl)-3,5-dimethylpyridazine (PubChem CID 144623526) has the molecular formula C13H13FN2 and a molecular weight of 216.26 g/mol. Its IUPAC name is 4-(2-fluoro-4-methylphenyl)-3,5-dimethylpyridazine.
| Compound Name | 4-(2-fluoro-4-methylphenyl)-3,5-dimethylpyridazine |
|---|---|
| PubChem CID | 144623526 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 4-(2-fluoro-4-methylphenyl)-3,5-dimethylpyridazine |
| SMILES | Cc1ccc(-c2c(C)cnnc2C)c(F)c1 |
| InChI | InChI=1S/C13H13FN2/c1-8-4-5-11(12(14)6-8)13-9(2)7-15-16-10(13)3/h4-7H,1-3H3 |
| InChIKey | VPHUMEAZIZJWKV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |