C13H13FN2O — CID 118448889
4-(2-fluoro-4-methoxyphenyl)-3,5-dimethylpyridazine (PubChem CID 118448889) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is 4-(2-fluoro-4-methoxyphenyl)-3,5-dimethylpyridazine.
| Compound Name | 4-(2-fluoro-4-methoxyphenyl)-3,5-dimethylpyridazine |
|---|---|
| PubChem CID | 118448889 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-(2-fluoro-4-methoxyphenyl)-3,5-dimethylpyridazine |
| SMILES | COc1ccc(-c2c(C)cnnc2C)c(F)c1 |
| InChI | InChI=1S/C13H13FN2O/c1-8-7-15-16-9(2)13(8)11-5-4-10(17-3)6-12(11)14/h4-7H,1-3H3 |
| InChIKey | ULTCJRLPFKLZKP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |