C11H22N2 — CID 164863019
3,4-dimethylpyridazine;ethane;propane (PubChem CID 164863019) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 3,4-dimethylpyridazine;ethane;propane.
| Compound Name | 3,4-dimethylpyridazine;ethane;propane |
|---|---|
| PubChem CID | 164863019 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 3,4-dimethylpyridazine;ethane;propane |
| SMILES | CC.CCC.Cc1ccnnc1C |
| InChI | InChI=1S/C6H8N2.C3H8.C2H6/c1-5-3-4-7-8-6(5)2;1-3-2;1-2/h3-4H,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | YXIAPUCWKJCUMH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |