C9H13N3O — CID 130684655
N-ethyl-N,3-dimethylpyridazine-4-carboxamide (PubChem CID 130684655) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N-ethyl-N,3-dimethylpyridazine-4-carboxamide.
| Compound Name | N-ethyl-N,3-dimethylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 130684655 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-ethyl-N,3-dimethylpyridazine-4-carboxamide |
| SMILES | CCN(C)C(=O)c1ccnnc1C |
| InChI | InChI=1S/C9H13N3O/c1-4-12(3)9(13)8-5-6-10-11-7(8)2/h5-6H,4H2,1-3H3 |
| InChIKey | RKTUTADNNYUVJG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |