C12H24N2 — CID 142319830
butane;3,4-dimethylpyridazine;ethane (PubChem CID 142319830) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is butane;3,4-dimethylpyridazine;ethane.
| Compound Name | butane;3,4-dimethylpyridazine;ethane |
|---|---|
| PubChem CID | 142319830 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | butane;3,4-dimethylpyridazine;ethane |
| SMILES | CC.CCCC.Cc1ccnnc1C |
| InChI | InChI=1S/C6H8N2.C4H10.C2H6/c1-5-3-4-7-8-6(5)2;1-3-4-2;1-2/h3-4H,1-2H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | IXEPIPOUEDREFS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |