C9H13N3 — CID 145045401
4,5-bis(ethenyl)triazine;ethane (PubChem CID 145045401) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 4,5-bis(ethenyl)triazine;ethane.
| Compound Name | 4,5-bis(ethenyl)triazine;ethane |
|---|---|
| PubChem CID | 145045401 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 4,5-bis(ethenyl)triazine;ethane |
| SMILES | C=Cc1cnnnc1C=C.CC |
| InChI | InChI=1S/C7H7N3.C2H6/c1-3-6-5-8-10-9-7(6)4-2;1-2/h3-5H,1-2H2;1-2H3 |
| InChIKey | MEGIWFJWEFPOCV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |