C15H19N3O3S — CID 163061420
7-hydroxy-2-methyl-1'-(thiophen-2-ylmethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione (PubChem CID 163061420) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 7-hydroxy-2-methyl-1'-(thiophen-2-ylmethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione.
| Compound Name | 7-hydroxy-2-methyl-1'-(thiophen-2-ylmethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione |
|---|---|
| PubChem CID | 163061420 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 7-hydroxy-2-methyl-1'-(thiophen-2-ylmethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione |
| SMILES | CN1C(=O)C2CC(O)CN2C2(CN(Cc3cccs3)C2)C1=O |
| InChI | InChI=1S/C15H19N3O3S/c1-16-13(20)12-5-10(19)6-18(12)15(14(16)21)8-17(9-15)7-11-3-2-4-22-11/h2-4,10,12,19H,5-9H2,1H3 |
| InChIKey | FVFHXEACLXEMII-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|