C15H23N3O5 — CID 162960595
methyl 2-(7-hydroxy-1,3-dioxo-1'-propan-2-ylspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl)acetate (PubChem CID 162960595) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 2-(7-hydroxy-1,3-dioxo-1'-propan-2-ylspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl)acetate.
| Compound Name | methyl 2-(7-hydroxy-1,3-dioxo-1'-propan-2-ylspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl)acetate |
|---|---|
| PubChem CID | 162960595 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | methyl 2-(7-hydroxy-1,3-dioxo-1'-propan-2-ylspiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl)acetate |
| SMILES | COC(=O)CN1C(=O)C2CC(O)CN2C2(CN(C(C)C)C2)C1=O |
| InChI | InChI=1S/C15H23N3O5/c1-9(2)16-7-15(8-16)14(22)17(6-12(20)23-3)13(21)11-4-10(19)5-18(11)15/h9-11,19H,4-8H2,1-3H3 |
| InChIKey | FLSBJAMZYYWMDR-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|