C21H26N4O6 — CID 100611661
methyl 2-[(7R,8aS)-1'-[(4-acetamidophenyl)methyl]-7-hydroxy-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate (PubChem CID 100611661) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is methyl 2-[(7R,8aS)-1'-[(4-acetamidophenyl)methyl]-7-hydroxy-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate.
| Compound Name | methyl 2-[(7R,8aS)-1'-[(4-acetamidophenyl)methyl]-7-hydroxy-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate |
|---|---|
| PubChem CID | 100611661 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | methyl 2-[(7R,8aS)-1'-[(4-acetamidophenyl)methyl]-7-hydroxy-1,3-dioxospiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-2-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@@H]2C[C@@H](O)CN2C2(CN(Cc3ccc(NC(C)=O)cc3)C2)C1=O |
| InChI | InChI=1S/C21H26N4O6/c1-13(26)22-15-5-3-14(4-6-15)8-23-11-21(12-23)20(30)24(10-18(28)31-2)19(29)17-7-16(27)9-25(17)21/h3-6,16-17,27H,7-12H2,1-2H3,(H,22,26)/t16-,17+/m1/s1 |
| InChIKey | XSNYVEBUZDSWKQ-SJORKVTESA-N |
| XLogP | -0.82 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|