C25H42N4O5 — CID 163061691
6-methyl-N-[7-methyl-3-(2-methylbutyl)-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]oct-2-enamide (PubChem CID 163061691) has the molecular formula C25H42N4O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is 6-methyl-N-[7-methyl-3-(2-methylbutyl)-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]oct-2-enamide.
| Compound Name | 6-methyl-N-[7-methyl-3-(2-methylbutyl)-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]oct-2-enamide |
|---|---|
| PubChem CID | 163061691 |
| Molecular Formula | C25H42N4O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | 6-methyl-N-[7-methyl-3-(2-methylbutyl)-2,5,6,9-tetraoxo-1,4,8-triazacyclotridec-10-yl]oct-2-enamide |
| SMILES | CCC(C)CCC=CC(=O)NC1CCCNC(=O)C(CC(C)CC)NC(=O)C(=O)C(C)NC1=O |
| InChI | InChI=1S/C25H42N4O5/c1-6-16(3)11-8-9-13-21(30)28-19-12-10-14-26-23(32)20(15-17(4)7-2)29-25(34)22(31)18(5)27-24(19)33/h9,13,16-20H,6-8,10-12,14-15H2,1-5H3,(H,26,32)(H,27,33)(H,28,30)(H,29,34) |
| InChIKey | UIIWGVFSKAALGX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|