C29H50O — CID 163062174
(8S,10R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-8,10-dimethyl-2,3,4,7,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 163062174) has the molecular formula C29H50O and a molecular weight of 414.72 g/mol. Its IUPAC name is (8S,10R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-8,10-dimethyl-2,3,4,7,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,10R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-8,10-dimethyl-2,3,4,7,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 163062174 |
| Molecular Formula | C29H50O |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.39 |
| IUPAC Name | (8S,10R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-8,10-dimethyl-2,3,4,7,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(CC[C@@H](C)C1CCC2C1CCC1[C@@]2(C)CC=C2CC(O)CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)24-10-12-26-25(24)11-13-27-28(5)17-15-23(30)18-22(28)14-16-29(26,27)6/h14,19-21,23-27,30H,7-13,15-18H2,1-6H3/t20-,21?,23?,24?,25?,26?,27?,28+,29+/m1/s1 |
| InChIKey | SJBCPIPTNBLBFY-LTKZRENRSA-N |
| XLogP | 8.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|