C22H34O7 — CID 163064897
2,4,5,6-tetrahydroxy-6-(hydroxymethyl)-3-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]cyclohex-2-en-1-one (PubChem CID 163064897) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2,4,5,6-tetrahydroxy-6-(hydroxymethyl)-3-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]cyclohex-2-en-1-one.
| Compound Name | 2,4,5,6-tetrahydroxy-6-(hydroxymethyl)-3-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163064897 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2,4,5,6-tetrahydroxy-6-(hydroxymethyl)-3-[[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]cyclohex-2-en-1-one |
| SMILES | C=C1CCC2C(C)(CO)CCCC2(C)C1CC1=C(O)C(=O)C(O)(CO)C(O)C1O |
| InChI | InChI=1S/C22H34O7/c1-12-5-6-15-20(2,10-23)7-4-8-21(15,3)14(12)9-13-16(25)18(27)22(29,11-24)19(28)17(13)26/h14-16,18,23-27,29H,1,4-11H2,2-3H3 |
| InChIKey | AOFSOKCCOSPZSP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|