C30H46O3 — CID 163065069
(3R,4R,4aS,6bS,9R,10aS,11bR)-3-hydroxy-4,11b-dimethyl-10-methylidene-9-[(2S)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4a,5,6,6b,7,8,9,10a,11-dodecahydrobenzo[a]fluorene-4-carboxylic acid (PubChem CID 163065069) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (3R,4R,4aS,6bS,9R,10aS,11bR)-3-hydroxy-4,11b-dimethyl-10-methylidene-9-[(2S)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4a,5,6,6b,7,8,9,10a,11-dodecahydrobenzo[a]fluorene-4-carboxylic acid.
| Compound Name | (3R,4R,4aS,6bS,9R,10aS,11bR)-3-hydroxy-4,11b-dimethyl-10-methylidene-9-[(2S)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4a,5,6,6b,7,8,9,10a,11-dodecahydrobenzo[a]fluorene-4-carboxylic acid |
|---|---|
| PubChem CID | 163065069 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (3R,4R,4aS,6bS,9R,10aS,11bR)-3-hydroxy-4,11b-dimethyl-10-methylidene-9-[(2S)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4a,5,6,6b,7,8,9,10a,11-dodecahydrobenzo[a]fluorene-4-carboxylic acid |
| SMILES | C=C(CC[C@H](C)[C@H]1CC[C@@H]2C3=C(C[C@@H]2C1=C)[C@]1(C)CC[C@@H](O)[C@](C)(C(=O)O)[C@H]1CC3)C(C)C |
| InChI | InChI=1S/C30H46O3/c1-17(2)18(3)8-9-19(4)21-10-11-22-23-12-13-26-29(6,25(23)16-24(22)20(21)5)15-14-27(31)30(26,7)28(32)33/h17,19,21-22,24,26-27,31H,3,5,8-16H2,1-2,4,6-7H3,(H,32,33)/t19-,21+,22+,24+,26-,27+,29-,30+/m0/s1 |
| InChIKey | NKDDWRFPMADJKX-PPVLAZIDSA-N |
| XLogP | 7.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|