C34H50O12 — CID 163065879
1,4a,7-trimethyl-7-[2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 163065879) has the molecular formula C34H50O12 and a molecular weight of 650.76 g/mol. Its IUPAC name is 1,4a,7-trimethyl-7-[2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | 1,4a,7-trimethyl-7-[2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 163065879 |
| Molecular Formula | C34H50O12 |
| Molecular Weight | 650.76 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | 1,4a,7-trimethyl-7-[2-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CC(=O)OCC1OC(OCCC2(C)CCC3C(=CCC4C(C)(C(=O)O)CCCC34C)C2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C34H50O12/c1-19(35)42-18-25-27(43-20(2)36)28(44-21(3)37)29(45-22(4)38)30(46-25)41-16-15-32(5)14-11-24-23(17-32)9-10-26-33(24,6)12-8-13-34(26,7)31(39)40/h9,24-30H,8,10-18H2,1-7H3,(H,39,40) |
| InChIKey | MXNIPMIDOUSAGP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|