C41H66O5 — CID 163066514
[(2S)-1-hexadec-9-enoyloxy-3-hydroxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 163066514) has the molecular formula C41H66O5 and a molecular weight of 638.97 g/mol. Its IUPAC name is [(2S)-1-hexadec-9-enoyloxy-3-hydroxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2S)-1-hexadec-9-enoyloxy-3-hydroxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 163066514 |
| Molecular Formula | C41H66O5 |
| Molecular Weight | 638.97 g/mol |
| Exact Mass | 638.49 |
| IUPAC Name | [(2S)-1-hexadec-9-enoyloxy-3-hydroxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C41H66O5/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-32-34-36-41(44)46-39(37-42)38-45-40(43)35-33-31-29-27-25-23-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-18,20-21,24,26,30,32,39,42H,3-4,6,8-10,12,15,19,22-23,25,27-29,31,33-38H2,1-2H3/t39-/m0/s1 |
| InChIKey | HVNZXEWOOPDEBR-KDXMTYKHSA-N |
| XLogP | 11.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.97 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|