C21H23NO8 — CID 163066950
3-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-pyridin-2-ylprop-2-en-1-one (PubChem CID 163066950) has the molecular formula C21H23NO8 and a molecular weight of 417.41 g/mol. Its IUPAC name is 3-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-pyridin-2-ylprop-2-en-1-one.
| Compound Name | 3-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 163066950 |
| Molecular Formula | C21H23NO8 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3-[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-1-pyridin-2-ylprop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccccn2)ccc1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C21H23NO8/c1-28-16-10-12(5-7-14(24)13-4-2-3-9-22-13)6-8-15(16)29-21-20(27)19(26)18(25)17(11-23)30-21/h2-10,17-21,23,25-27H,11H2,1H3 |
| InChIKey | YZJZNRCBNBKMAS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|