C25H25N3O6 — CID 163068120
(1R,3R,3aS,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-7'-ethyl-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 163068120) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is (1R,3R,3aS,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-7'-ethyl-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3R,3aS,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-7'-ethyl-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 163068120 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | (1R,3R,3aS,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-7'-ethyl-1-[(1R)-1-hydroxyethyl]spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CCc1cccc2c1NC(=O)[C@]21N[C@@H]([C@@H](C)O)[C@H]2C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)[C@@H]21 |
| InChI | InChI=1S/C25H25N3O6/c1-3-14-5-4-6-15-21(14)26-24(32)25(15)19-18(20(27-25)12(2)29)22(30)28(23(19)31)10-13-7-8-16-17(9-13)34-11-33-16/h4-9,12,18-20,27,29H,3,10-11H2,1-2H3,(H,26,32)/t12-,18+,19-,20+,25+/m1/s1 |
| InChIKey | CPBSHRHZWWGOEB-NMIANDEKSA-N |
| XLogP | 1.28 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|