C29H25N3O6 — CID 26883923
(1R,3S,3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-1-[(4-hydroxyphenyl)methyl]-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 26883923) has the molecular formula C29H25N3O6 and a molecular weight of 511.53 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-1-[(4-hydroxyphenyl)methyl]-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-1-[(4-hydroxyphenyl)methyl]-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 26883923 |
| Molecular Formula | C29H25N3O6 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (1R,3S,3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-1-[(4-hydroxyphenyl)methyl]-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | Cc1cccc2c1NC(=O)[C@@]21N[C@H](Cc2ccc(O)cc2)[C@H]2C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)[C@H]21 |
| InChI | InChI=1S/C29H25N3O6/c1-15-3-2-4-19-25(15)30-28(36)29(19)24-23(20(31-29)11-16-5-8-18(33)9-6-16)26(34)32(27(24)35)13-17-7-10-21-22(12-17)38-14-37-21/h2-10,12,20,23-24,31,33H,11,13-14H2,1H3,(H,30,36)/t20-,23-,24+,29-/m1/s1 |
| InChIKey | UBEYPJWMLZAJLZ-ZFASCNIYSA-N |
| XLogP | 2.59 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|