C31H25ClN4O5 — CID 124796299
(1R,3S,3aR,6aR)-5-(1,3-benzodioxol-5-ylmethyl)-5'-chloro-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 124796299) has the molecular formula C31H25ClN4O5 and a molecular weight of 569.02 g/mol. Its IUPAC name is (1R,3S,3aR,6aR)-5-(1,3-benzodioxol-5-ylmethyl)-5'-chloro-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (1R,3S,3aR,6aR)-5-(1,3-benzodioxol-5-ylmethyl)-5'-chloro-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 124796299 |
| Molecular Formula | C31H25ClN4O5 |
| Molecular Weight | 569.02 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | (1R,3S,3aR,6aR)-5-(1,3-benzodioxol-5-ylmethyl)-5'-chloro-1-(1H-indol-3-ylmethyl)-7'-methylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | Cc1cc(Cl)cc2c1NC(=O)[C@@]21N[C@H](Cc2c[nH]c3ccccc23)[C@@H]2C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)[C@H]21 |
| InChI | InChI=1S/C31H25ClN4O5/c1-15-8-18(32)11-20-27(15)34-30(39)31(20)26-25(22(35-31)10-17-12-33-21-5-3-2-4-19(17)21)28(37)36(29(26)38)13-16-6-7-23-24(9-16)41-14-40-23/h2-9,11-12,22,25-26,33,35H,10,13-14H2,1H3,(H,34,39)/t22-,25+,26+,31-/m1/s1 |
| InChIKey | DXBFPRWETVBCRR-INJHZYCUSA-N |
| XLogP | 4.02 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.02 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|