C32H44O4S — CID 163069614
[(2S,4aS,4bR,6aR,6bR,10aS,11aR,11bR)-6b-acetyl-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,8,9,10,10a,11,11a,11b,12-hexadecahydroindeno[2,1-a]phenanthren-2-yl] 4-methylbenzenesulfonate (PubChem CID 163069614) has the molecular formula C32H44O4S and a molecular weight of 524.77 g/mol. Its IUPAC name is [(2S,4aS,4bR,6aR,6bR,10aS,11aR,11bR)-6b-acetyl-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,8,9,10,10a,11,11a,11b,12-hexadecahydroindeno[2,1-a]phenanthren-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,4aS,4bR,6aR,6bR,10aS,11aR,11bR)-6b-acetyl-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,8,9,10,10a,11,11a,11b,12-hexadecahydroindeno[2,1-a]phenanthren-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 163069614 |
| Molecular Formula | C32H44O4S |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [(2S,4aS,4bR,6aR,6bR,10aS,11aR,11bR)-6b-acetyl-4a,6a-dimethyl-1,2,3,4,4b,5,6,7,8,9,10,10a,11,11a,11b,12-hexadecahydroindeno[2,1-a]phenanthren-2-yl] 4-methylbenzenesulfonate |
| SMILES | CC(=O)[C@]12CCCC[C@H]1C[C@@H]1[C@@H]3CC=C4C[C@@H](OS(=O)(=O)c5ccc(C)cc5)CC[C@@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C32H44O4S/c1-21-8-11-26(12-9-21)37(34,35)36-25-14-17-30(3)23(19-25)10-13-27-28(30)15-18-31(4)29(27)20-24-7-5-6-16-32(24,31)22(2)33/h8-12,24-25,27-29H,5-7,13-20H2,1-4H3/t24-,25-,27+,28+,29+,30+,31+,32+/m0/s1 |
| InChIKey | KMDHIRGFRAIIQQ-KSLYBPANSA-N |
| XLogP | 7.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|