C26H35NO4 — CID 163071719
1-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6,10-dimethyl-3-methylideneundeca-5,9-dien-2-one (PubChem CID 163071719) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6,10-dimethyl-3-methylideneundeca-5,9-dien-2-one.
| Compound Name | 1-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6,10-dimethyl-3-methylideneundeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 163071719 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 1-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6,10-dimethyl-3-methylideneundeca-5,9-dien-2-one |
| SMILES | C=C(CC=C(C)CCC=C(C)C)C(=O)C[C@@H]1c2c(cc3c(c2OC)OCO3)CCN1C |
| InChI | InChI=1S/C26H35NO4/c1-17(2)8-7-9-18(3)10-11-19(4)22(28)15-21-24-20(12-13-27(21)5)14-23-25(26(24)29-6)31-16-30-23/h8,10,14,21H,4,7,9,11-13,15-16H2,1-3,5-6H3/t21-/m1/s1 |
| InChIKey | XHSRFCRGSWRBSP-OAQYLSRUSA-N |
| XLogP | 5.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|