C24H34N2O4 — CID 163062958
N-[1-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-5,5,8-trimethylnona-3,7-dien-2-ylidene]hydroxylamine (PubChem CID 163062958) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[1-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-5,5,8-trimethylnona-3,7-dien-2-ylidene]hydroxylamine.
| Compound Name | N-[1-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-5,5,8-trimethylnona-3,7-dien-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 163062958 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | N-[1-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-5,5,8-trimethylnona-3,7-dien-2-ylidene]hydroxylamine |
| SMILES | COc1c2c(cc3c1[C@H](CC(C=CC(C)(C)CC=C(C)C)=NO)N(C)CC3)OCO2 |
| InChI | InChI=1S/C24H34N2O4/c1-16(2)7-10-24(3,4)11-8-18(25-27)14-19-21-17(9-12-26(19)5)13-20-22(23(21)28-6)30-15-29-20/h7-8,11,13,19,27H,9-10,12,14-15H2,1-6H3/t19-/m0/s1 |
| InChIKey | CQQAESOLIQHLRS-IBGZPJMESA-N |
| XLogP | 5.11 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|