C15H17F3N2O4 — CID 3554281
N-[1,1,1-trifluoro-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)propan-2-ylidene]hydroxylamine (PubChem CID 3554281) has the molecular formula C15H17F3N2O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is N-[1,1,1-trifluoro-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)propan-2-ylidene]hydroxylamine.
| Compound Name | N-[1,1,1-trifluoro-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 3554281 |
| Molecular Formula | C15H17F3N2O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[1,1,1-trifluoro-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)propan-2-ylidene]hydroxylamine |
| SMILES | COc1c2c(cc3c1C(CC(=NO)C(F)(F)F)N(C)CC3)OCO2 |
| InChI | InChI=1S/C15H17F3N2O4/c1-20-4-3-8-5-10-13(24-7-23-10)14(22-2)12(8)9(20)6-11(19-21)15(16,17)18/h5,9,21H,3-4,6-7H2,1-2H3 |
| InChIKey | SSLINGPLJYLXKA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|