C21H30N2O5 — CID 7078006
N-[1-[(4S)-2,2-dimethyloxan-4-yl]-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethylidene]hydroxylamine (PubChem CID 7078006) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[1-[(4S)-2,2-dimethyloxan-4-yl]-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[(4S)-2,2-dimethyloxan-4-yl]-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 7078006 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | N-[1-[(4S)-2,2-dimethyloxan-4-yl]-2-[(5S)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]ethylidene]hydroxylamine |
| SMILES | COc1c2c(cc3c1[C@H](CC(=NO)[C@H]1CCOC(C)(C)C1)N(C)CC3)OCO2 |
| InChI | InChI=1S/C21H30N2O5/c1-21(2)11-14(6-8-28-21)15(22-24)10-16-18-13(5-7-23(16)3)9-17-19(20(18)25-4)27-12-26-17/h9,14,16,24H,5-8,10-12H2,1-4H3/t14-,16-/m0/s1 |
| InChIKey | MBZNYRATEUMHTI-HOCLYGCPSA-N |
| XLogP | 3.38 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|