C24H30N2O5 — CID 40559150
(NZ)-N-[1-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-3-(4-propan-2-yloxyphenyl)propan-2-ylidene]hydroxylamine (PubChem CID 40559150) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (NZ)-N-[1-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-3-(4-propan-2-yloxyphenyl)propan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-3-(4-propan-2-yloxyphenyl)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 40559150 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (NZ)-N-[1-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-3-(4-propan-2-yloxyphenyl)propan-2-ylidene]hydroxylamine |
| SMILES | COc1c2c(cc3c1[C@@H](C/C(Cc1ccc(OC(C)C)cc1)=N\O)N(C)CC3)OCO2 |
| InChI | InChI=1S/C24H30N2O5/c1-15(2)31-19-7-5-16(6-8-19)11-18(25-27)13-20-22-17(9-10-26(20)3)12-21-23(24(22)28-4)30-14-29-21/h5-8,12,15,20,27H,9-11,13-14H2,1-4H3/b25-18-/t20-/m1/s1 |
| InChIKey | GDGOCISBYQZCJR-SWYXWEQBSA-N |
| XLogP | 4.20 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|