C29H48O4 — CID 163071906
17-(5-ethyl-6-methylheptan-2-yl)-3,9,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-one (PubChem CID 163071906) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is 17-(5-ethyl-6-methylheptan-2-yl)-3,9,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-one.
| Compound Name | 17-(5-ethyl-6-methylheptan-2-yl)-3,9,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 163071906 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 17-(5-ethyl-6-methylheptan-2-yl)-3,9,15-trihydroxy-10,13-dimethyl-2,3,4,5,6,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-one |
| SMILES | CCC(CCC(C)C1CC(O)C2=C3C(=O)CC4CC(O)CCC4(C)C3(O)CCC21C)C(C)C |
| InChI | InChI=1S/C29H48O4/c1-7-19(17(2)3)9-8-18(4)22-16-24(32)25-26-23(31)15-20-14-21(30)10-11-28(20,6)29(26,33)13-12-27(22,25)5/h17-22,24,30,32-33H,7-16H2,1-6H3 |
| InChIKey | LRZBZOYEXVMHPC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |