C29H46O3 — CID 162945344
17-(5,6-dimethylheptan-2-yl)-3,9-dihydroxy-10,13-dimethyl-4-methylidene-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-15-one (PubChem CID 162945344) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is 17-(5,6-dimethylheptan-2-yl)-3,9-dihydroxy-10,13-dimethyl-4-methylidene-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-15-one.
| Compound Name | 17-(5,6-dimethylheptan-2-yl)-3,9-dihydroxy-10,13-dimethyl-4-methylidene-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-15-one |
|---|---|
| PubChem CID | 162945344 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 17-(5,6-dimethylheptan-2-yl)-3,9-dihydroxy-10,13-dimethyl-4-methylidene-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-15-one |
| SMILES | C=C1C(O)CCC2(C)C1CCC1=C3C(=O)CC(C(C)CCC(C)C(C)C)C3(C)CCC12O |
| InChI | InChI=1S/C29H46O3/c1-17(2)18(3)8-9-19(4)23-16-25(31)26-22-11-10-21-20(5)24(30)12-13-28(21,7)29(22,32)15-14-27(23,26)6/h17-19,21,23-24,30,32H,5,8-16H2,1-4,6-7H3 |
| InChIKey | UUNSVTLYXUARLO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|