C29H48O4 — CID 76534100
17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-4-methylidene-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11,14,15-tetrol (PubChem CID 76534100) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is 17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-4-methylidene-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11,14,15-tetrol.
| Compound Name | 17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-4-methylidene-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11,14,15-tetrol |
|---|---|
| PubChem CID | 76534100 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-4-methylidene-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,11,14,15-tetrol |
| SMILES | C=C1C(O)CCC2(C)C3=C(CCC12)C1(O)C(O)CC(C(C)CCC(C)C(C)C)C1(C)CC3O |
| InChI | InChI=1S/C29H48O4/c1-16(2)17(3)8-9-18(4)22-14-25(32)29(33)21-11-10-20-19(5)23(30)12-13-27(20,6)26(21)24(31)15-28(22,29)7/h16-18,20,22-25,30-33H,5,8-15H2,1-4,6-7H3 |
| InChIKey | CLYWNNIJUWKOSH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|