C29H46O3 — CID 162931883
13-(5,6-dimethylheptan-2-yl)-1,5-dihydroxy-2,14-dimethyl-6-methylidenetetracyclo[7.7.1.02,7.014,17]heptadec-9(17)-en-10-one (PubChem CID 162931883) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is 13-(5,6-dimethylheptan-2-yl)-1,5-dihydroxy-2,14-dimethyl-6-methylidenetetracyclo[7.7.1.02,7.014,17]heptadec-9(17)-en-10-one.
| Compound Name | 13-(5,6-dimethylheptan-2-yl)-1,5-dihydroxy-2,14-dimethyl-6-methylidenetetracyclo[7.7.1.02,7.014,17]heptadec-9(17)-en-10-one |
|---|---|
| PubChem CID | 162931883 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 13-(5,6-dimethylheptan-2-yl)-1,5-dihydroxy-2,14-dimethyl-6-methylidenetetracyclo[7.7.1.02,7.014,17]heptadec-9(17)-en-10-one |
| SMILES | C=C1C(O)CCC2(C)C1CC1=C3C(C)(CCC32O)C(C(C)CCC(C)C(C)C)CCC1=O |
| InChI | InChI=1S/C29H46O3/c1-17(2)18(3)8-9-19(4)22-10-11-25(31)21-16-23-20(5)24(30)12-13-28(23,7)29(32)15-14-27(22,6)26(21)29/h17-19,22-24,30,32H,5,8-16H2,1-4,6-7H3 |
| InChIKey | OSDBFYYNQOZBLN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|