C29H48O3 — CID 76534099
17-(5,6-dimethylheptan-2-yl)-14-hydroperoxy-10,13-dimethyl-4-methylidene-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 76534099) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is 17-(5,6-dimethylheptan-2-yl)-14-hydroperoxy-10,13-dimethyl-4-methylidene-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-(5,6-dimethylheptan-2-yl)-14-hydroperoxy-10,13-dimethyl-4-methylidene-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 76534099 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | 17-(5,6-dimethylheptan-2-yl)-14-hydroperoxy-10,13-dimethyl-4-methylidene-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C1C(O)CCC2(C)C1CC=C1C2CCC2(C)C(C(C)CCC(C)C(C)C)CCC12OO |
| InChI | InChI=1S/C29H48O3/c1-18(2)19(3)8-9-20(4)22-13-17-29(32-31)25-11-10-23-21(5)26(30)14-15-27(23,6)24(25)12-16-28(22,29)7/h11,18-20,22-24,26,30-31H,5,8-10,12-17H2,1-4,6-7H3 |
| InChIKey | XFGFTHAGNDOXJI-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|