C18H23NO2 — CID 163074299
(1R,5R)-2-[1-[(4-methoxyphenyl)methylamino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one (PubChem CID 163074299) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (1R,5R)-2-[1-[(4-methoxyphenyl)methylamino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one.
| Compound Name | (1R,5R)-2-[1-[(4-methoxyphenyl)methylamino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 163074299 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (1R,5R)-2-[1-[(4-methoxyphenyl)methylamino]ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
| SMILES | COc1ccc(CNC(C)=C2C(=O)C[C@@H]3[C@@H]2C3(C)C)cc1 |
| InChI | InChI=1S/C18H23NO2/c1-11(16-15(20)9-14-17(16)18(14,2)3)19-10-12-5-7-13(21-4)8-6-12/h5-8,14,17,19H,9-10H2,1-4H3/t14-,17+/m1/s1 |
| InChIKey | AQWGWMZCVZFNSU-PBHICJAKSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|