C20H26O7 — CID 163074588
(6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-4-yl) 4-hydroxy-2-(hydroxymethyl)but-2-enoate (PubChem CID 163074588) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is (6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-4-yl) 4-hydroxy-2-(hydroxymethyl)but-2-enoate.
| Compound Name | (6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-4-yl) 4-hydroxy-2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 163074588 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-4-yl) 4-hydroxy-2-(hydroxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)OC2C3=C(C)CCC(O)C3(C)CC(OC(=O)C(=CCO)CO)C12 |
| InChI | InChI=1S/C20H26O7/c1-10-4-5-14(23)20(3)8-13(26-19(25)12(9-22)6-7-21)15-11(2)18(24)27-17(15)16(10)20/h6,13-15,17,21-23H,2,4-5,7-9H2,1,3H3 |
| InChIKey | PGUAGAYXKYJYDR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|